C13H17F2N3 — CID 81294220
4-(1-aminohexan-2-ylamino)-3,5-difluorobenzonitrile (PubChem CID 81294220) has the molecular formula C13H17F2N3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(1-aminohexan-2-ylamino)-3,5-difluorobenzonitrile.
| Compound Name | 4-(1-aminohexan-2-ylamino)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81294220 |
| Molecular Formula | C13H17F2N3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 4-(1-aminohexan-2-ylamino)-3,5-difluorobenzonitrile |
| SMILES | CCCCC(CN)Nc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C13H17F2N3/c1-2-3-4-10(8-17)18-13-11(14)5-9(7-16)6-12(13)15/h5-6,10,18H,2-4,8,17H2,1H3 |
| InChIKey | ZCCDNYPINOGOEB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |