C14H21N3O2S — CID 80697698
N-(1-aminohexan-2-yl)-1-(4-cyanophenyl)methanesulfonamide (PubChem CID 80697698) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-1-(4-cyanophenyl)methanesulfonamide.
| Compound Name | N-(1-aminohexan-2-yl)-1-(4-cyanophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 80697698 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-(1-aminohexan-2-yl)-1-(4-cyanophenyl)methanesulfonamide |
| SMILES | CCCCC(CN)NS(=O)(=O)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H21N3O2S/c1-2-3-4-14(10-16)17-20(18,19)11-13-7-5-12(9-15)6-8-13/h5-8,14,17H,2-4,10-11,16H2,1H3 |
| InChIKey | KFYUCTFEJYEPQD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |