C15H25Cl2N3 — CID 106889815
2,6-dichloro-1-N-[5-(diethylamino)pentan-2-yl]benzene-1,4-diamine (PubChem CID 106889815) has the molecular formula C15H25Cl2N3 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2,6-dichloro-1-N-[5-(diethylamino)pentan-2-yl]benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-[5-(diethylamino)pentan-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 106889815 |
| Molecular Formula | C15H25Cl2N3 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2,6-dichloro-1-N-[5-(diethylamino)pentan-2-yl]benzene-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C15H25Cl2N3/c1-4-20(5-2)8-6-7-11(3)19-15-13(16)9-12(18)10-14(15)17/h9-11,19H,4-8,18H2,1-3H3 |
| InChIKey | BGQBOLSXAVVPLT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|