C10H12ClN3 — CID 83072944
2-(butan-2-ylamino)-6-chloropyridine-4-carbonitrile (PubChem CID 83072944) has the molecular formula C10H12ClN3 and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-6-chloropyridine-4-carbonitrile.
| Compound Name | 2-(butan-2-ylamino)-6-chloropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 83072944 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-(butan-2-ylamino)-6-chloropyridine-4-carbonitrile |
| SMILES | CCC(C)Nc1cc(C#N)cc(Cl)n1 |
| InChI | InChI=1S/C10H12ClN3/c1-3-7(2)13-10-5-8(6-12)4-9(11)14-10/h4-5,7H,3H2,1-2H3,(H,13,14) |
| InChIKey | REVJSJQNVVCDEB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|