C12H15ClN4O — CID 113408047
2-[(6-chloro-4-cyano-2-pyridinyl)amino]-N-propan-2-ylpropanamide (PubChem CID 113408047) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 2-[(6-chloro-4-cyano-2-pyridinyl)amino]-N-propan-2-ylpropanamide.
| Compound Name | 2-[(6-chloro-4-cyano-2-pyridinyl)amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 113408047 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-[(6-chloro-4-cyano-2-pyridinyl)amino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(C)Nc1cc(C#N)cc(Cl)n1 |
| InChI | InChI=1S/C12H15ClN4O/c1-7(2)15-12(18)8(3)16-11-5-9(6-14)4-10(13)17-11/h4-5,7-8H,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | JDDOWDDIEKJWBS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|