C7H8Cl2N4O2 — CID 83204348
2-[(3,6-dichloropyridazin-4-yl)amino]ethyl carbamate (PubChem CID 83204348) has the molecular formula C7H8Cl2N4O2 and a molecular weight of 251.07 g/mol. Its IUPAC name is 2-[(3,6-dichloropyridazin-4-yl)amino]ethyl carbamate.
| Compound Name | 2-[(3,6-dichloropyridazin-4-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83204348 |
| Molecular Formula | C7H8Cl2N4O2 |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-[(3,6-dichloropyridazin-4-yl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C7H8Cl2N4O2/c8-5-3-4(6(9)13-12-5)11-1-2-15-7(10)14/h3H,1-2H2,(H2,10,14)(H,11,12) |
| InChIKey | ORMQPXVCPVSDPA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|