C7H9Cl2N3 — CID 23242655
3,6-dichloro-N-propylpyridazin-4-amine (PubChem CID 23242655) has the molecular formula C7H9Cl2N3 and a molecular weight of 206.08 g/mol. Its IUPAC name is 3,6-dichloro-N-propylpyridazin-4-amine.
| Compound Name | 3,6-dichloro-N-propylpyridazin-4-amine |
|---|---|
| PubChem CID | 23242655 |
| Molecular Formula | C7H9Cl2N3 |
| Molecular Weight | 206.08 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 3,6-dichloro-N-propylpyridazin-4-amine |
| SMILES | CCCNc1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C7H9Cl2N3/c1-2-3-10-5-4-6(8)11-12-7(5)9/h4H,2-3H2,1H3,(H,10,11) |
| InChIKey | GTWKBBXQMBTJKB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.08 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |