C11H11ClN4 — CID 154972840
6-chloro-4-(propylamino)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile (PubChem CID 154972840) has the molecular formula C11H11ClN4 and a molecular weight of 234.69 g/mol. Its IUPAC name is 6-chloro-4-(propylamino)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile.
| Compound Name | 6-chloro-4-(propylamino)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154972840 |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 6-chloro-4-(propylamino)-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile |
| SMILES | CCCNc1cc(Cl)nc2[nH]cc(C#N)c12 |
| InChI | InChI=1S/C11H11ClN4/c1-2-3-14-8-4-9(12)16-11-10(8)7(5-13)6-15-11/h4,6H,2-3H2,1H3,(H2,14,15,16) |
| InChIKey | PVRCJFZTOBIABD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|