C9H4ClN3O — CID 146013293
7-chloro-4-oxo-1H-1,8-naphthyridine-3-carbonitrile (PubChem CID 146013293) has the molecular formula C9H4ClN3O and a molecular weight of 205.60 g/mol. Its IUPAC name is 7-chloro-4-oxo-1H-1,8-naphthyridine-3-carbonitrile.
| Compound Name | 7-chloro-4-oxo-1H-1,8-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146013293 |
| Molecular Formula | C9H4ClN3O |
| Molecular Weight | 205.60 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | 7-chloro-4-oxo-1H-1,8-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2nc(Cl)ccc2c1=O |
| InChI | InChI=1S/C9H4ClN3O/c10-7-2-1-6-8(14)5(3-11)4-12-9(6)13-7/h1-2,4H,(H,12,13,14) |
| InChIKey | VFURFQRHSDWPNJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.60 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|