C10H6ClN7O2 — CID 21434996
7-chloro-4-oxo-N-(2H-tetrazol-5-yl)-1H-1,8-naphthyridine-3-carboxamide (PubChem CID 21434996) has the molecular formula C10H6ClN7O2 and a molecular weight of 291.66 g/mol. Its IUPAC name is 7-chloro-4-oxo-N-(2H-tetrazol-5-yl)-1H-1,8-naphthyridine-3-carboxamide.
| Compound Name | 7-chloro-4-oxo-N-(2H-tetrazol-5-yl)-1H-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 21434996 |
| Molecular Formula | C10H6ClN7O2 |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 7-chloro-4-oxo-N-(2H-tetrazol-5-yl)-1H-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1nn[nH]n1)c1c[nH]c2nc(Cl)ccc2c1=O |
| InChI | InChI=1S/C10H6ClN7O2/c11-6-2-1-4-7(19)5(3-12-8(4)13-6)9(20)14-10-15-17-18-16-10/h1-3H,(H,12,13,19)(H2,14,15,16,17,18,20) |
| InChIKey | IRVFQRNEXKKVFO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|