C11H11ClF3N3O — CID 154972841
6-chloro-N-(2-methoxyethyl)-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 154972841) has the molecular formula C11H11ClF3N3O and a molecular weight of 293.68 g/mol. Its IUPAC name is 6-chloro-N-(2-methoxyethyl)-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 6-chloro-N-(2-methoxyethyl)-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 154972841 |
| Molecular Formula | C11H11ClF3N3O |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 6-chloro-N-(2-methoxyethyl)-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | COCCNc1cc(Cl)nc2[nH]cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C11H11ClF3N3O/c1-19-3-2-16-7-4-8(12)18-10-9(7)6(5-17-10)11(13,14)15/h4-5H,2-3H2,1H3,(H2,16,17,18) |
| InChIKey | XERXNDPEDCSBBM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|