C18H18F3N3O — CID 167350850
N-(2-methoxyethyl)-2-methyl-6-[7-(trifluoromethyl)-1H-indol-3-yl]pyridin-3-amine (PubChem CID 167350850) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-methyl-6-[7-(trifluoromethyl)-1H-indol-3-yl]pyridin-3-amine.
| Compound Name | N-(2-methoxyethyl)-2-methyl-6-[7-(trifluoromethyl)-1H-indol-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 167350850 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-(2-methoxyethyl)-2-methyl-6-[7-(trifluoromethyl)-1H-indol-3-yl]pyridin-3-amine |
| SMILES | COCCNc1ccc(-c2c[nH]c3c(C(F)(F)F)cccc23)nc1C |
| InChI | InChI=1S/C18H18F3N3O/c1-11-15(22-8-9-25-2)6-7-16(24-11)13-10-23-17-12(13)4-3-5-14(17)18(19,20)21/h3-7,10,22-23H,8-9H2,1-2H3 |
| InChIKey | ODZUHCKJGGIJPP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|