C17H16F3N3O — CID 56906336
N-(2-methoxyethyl)-4-[3-(trifluoromethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 56906336) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[3-(trifluoromethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-amine.
| Compound Name | N-(2-methoxyethyl)-4-[3-(trifluoromethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-amine |
|---|---|
| PubChem CID | 56906336 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-(2-methoxyethyl)-4-[3-(trifluoromethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | COCCNc1cc(-c2cccc(C(F)(F)F)c2)c2cc[nH]c2n1 |
| InChI | InChI=1S/C17H16F3N3O/c1-24-8-7-21-15-10-14(13-5-6-22-16(13)23-15)11-3-2-4-12(9-11)17(18,19)20/h2-6,9-10H,7-8H2,1H3,(H2,21,22,23) |
| InChIKey | JXIHMAWATHRPSA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|