C14H14F3N3O3S — CID 58878046
2-[[2-methylsulfonyl-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]ethanol (PubChem CID 58878046) has the molecular formula C14H14F3N3O3S and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-[[2-methylsulfonyl-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[2-methylsulfonyl-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 58878046 |
| Molecular Formula | C14H14F3N3O3S |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-[[2-methylsulfonyl-6-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]ethanol |
| SMILES | CS(=O)(=O)c1nc(NCCO)cc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H14F3N3O3S/c1-24(22,23)13-19-11(8-12(20-13)18-5-6-21)9-3-2-4-10(7-9)14(15,16)17/h2-4,7-8,21H,5-6H2,1H3,(H,18,19,20) |
| InChIKey | FGGFQJOUHIWMNJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |