C19H14F3NO4S — CID 151693176
methyl 6-methylsulfonyl-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylate (PubChem CID 151693176) has the molecular formula C19H14F3NO4S and a molecular weight of 409.39 g/mol. Its IUPAC name is methyl 6-methylsulfonyl-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylate.
| Compound Name | methyl 6-methylsulfonyl-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 151693176 |
| Molecular Formula | C19H14F3NO4S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | methyl 6-methylsulfonyl-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(C(F)(F)F)c2)nc2ccc(S(C)(=O)=O)cc12 |
| InChI | InChI=1S/C19H14F3NO4S/c1-27-18(24)15-10-17(11-4-3-5-12(8-11)19(20,21)22)23-16-7-6-13(9-14(15)16)28(2,25)26/h3-10H,1-2H3 |
| InChIKey | RCZRRIUDOQNSEV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |