C13H7F6NO2 — CID 125494080
methyl 2,6-bis(trifluoromethyl)quinoline-4-carboxylate (PubChem CID 125494080) has the molecular formula C13H7F6NO2 and a molecular weight of 323.19 g/mol. Its IUPAC name is methyl 2,6-bis(trifluoromethyl)quinoline-4-carboxylate.
| Compound Name | methyl 2,6-bis(trifluoromethyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 125494080 |
| Molecular Formula | C13H7F6NO2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | methyl 2,6-bis(trifluoromethyl)quinoline-4-carboxylate |
| SMILES | COC(=O)c1cc(C(F)(F)F)nc2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C13H7F6NO2/c1-22-11(21)8-5-10(13(17,18)19)20-9-3-2-6(4-7(8)9)12(14,15)16/h2-5H,1H3 |
| InChIKey | MLPXDYFNVHDXTF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |