C27H22F3NO3 — CID 170148709
methyl 2-[4-(4-propan-2-yloxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylate (PubChem CID 170148709) has the molecular formula C27H22F3NO3 and a molecular weight of 465.47 g/mol. Its IUPAC name is methyl 2-[4-(4-propan-2-yloxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylate.
| Compound Name | methyl 2-[4-(4-propan-2-yloxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 170148709 |
| Molecular Formula | C27H22F3NO3 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | methyl 2-[4-(4-propan-2-yloxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(-c3ccc(OC(C)C)cc3)cc2)nc2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C27H22F3NO3/c1-16(2)34-21-11-8-18(9-12-21)17-4-6-19(7-5-17)25-15-23(26(32)33-3)22-14-20(27(28,29)30)10-13-24(22)31-25/h4-16H,1-3H3 |
| InChIKey | KOPFZWLAOVQFKC-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |