C24H15F4NO2 — CID 160851674
2-[4-(3-fluoro-5-methylphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid (PubChem CID 160851674) has the molecular formula C24H15F4NO2 and a molecular weight of 425.38 g/mol. Its IUPAC name is 2-[4-(3-fluoro-5-methylphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid.
| Compound Name | 2-[4-(3-fluoro-5-methylphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 160851674 |
| Molecular Formula | C24H15F4NO2 |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[4-(3-fluoro-5-methylphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid |
| SMILES | Cc1cc(F)cc(-c2ccc(-c3cc(C(=O)O)c4cc(C(F)(F)F)ccc4n3)cc2)c1 |
| InChI | InChI=1S/C24H15F4NO2/c1-13-8-16(10-18(25)9-13)14-2-4-15(5-3-14)22-12-20(23(30)31)19-11-17(24(26,27)28)6-7-21(19)29-22/h2-12H,1H3,(H,30,31) |
| InChIKey | JUOLXASHEULCIQ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |