C18H11F4NO3 — CID 4619139
2-(5-fluoro-2-methoxyphenyl)-6-(trifluoromethyl)quinoline-4-carboxylic acid (PubChem CID 4619139) has the molecular formula C18H11F4NO3 and a molecular weight of 365.28 g/mol. Its IUPAC name is 2-(5-fluoro-2-methoxyphenyl)-6-(trifluoromethyl)quinoline-4-carboxylic acid.
| Compound Name | 2-(5-fluoro-2-methoxyphenyl)-6-(trifluoromethyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4619139 |
| Molecular Formula | C18H11F4NO3 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-(5-fluoro-2-methoxyphenyl)-6-(trifluoromethyl)quinoline-4-carboxylic acid |
| SMILES | COc1ccc(F)cc1-c1cc(C(=O)O)c2cc(C(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C18H11F4NO3/c1-26-16-5-3-10(19)7-13(16)15-8-12(17(24)25)11-6-9(18(20,21)22)2-4-14(11)23-15/h2-8H,1H3,(H,24,25) |
| InChIKey | MXILFEXRSPDFJU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |