C15H8F4O4 — CID 173322333
2-(2-carboxy-5-fluorophenyl)-4-(trifluoromethyl)benzoic acid (PubChem CID 173322333) has the molecular formula C15H8F4O4 and a molecular weight of 328.22 g/mol. Its IUPAC name is 2-(2-carboxy-5-fluorophenyl)-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(2-carboxy-5-fluorophenyl)-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 173322333 |
| Molecular Formula | C15H8F4O4 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-(2-carboxy-5-fluorophenyl)-4-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(F)cc1-c1cc(C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C15H8F4O4/c16-8-2-4-10(14(22)23)12(6-8)11-5-7(15(17,18)19)1-3-9(11)13(20)21/h1-6H,(H,20,21)(H,22,23) |
| InChIKey | KFHJIJKARJAOKU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |