C19H14F3NO4 — CID 3469599
2-(2,5-dimethoxyphenyl)-8-(trifluoromethyl)quinoline-4-carboxylic acid (PubChem CID 3469599) has the molecular formula C19H14F3NO4 and a molecular weight of 377.32 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-8-(trifluoromethyl)quinoline-4-carboxylic acid.
| Compound Name | 2-(2,5-dimethoxyphenyl)-8-(trifluoromethyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3469599 |
| Molecular Formula | C19H14F3NO4 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-8-(trifluoromethyl)quinoline-4-carboxylic acid |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)O)c3cccc(C(F)(F)F)c3n2)c1 |
| InChI | InChI=1S/C19H14F3NO4/c1-26-10-6-7-16(27-2)13(8-10)15-9-12(18(24)25)11-4-3-5-14(17(11)23-15)19(20,21)22/h3-9H,1-2H3,(H,24,25) |
| InChIKey | YKHBGQCJGGDXKK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |