C19H14F3NO3 — CID 4041653
2-(4-methoxy-2-methylphenyl)-8-(trifluoromethyl)quinoline-4-carboxylic acid (PubChem CID 4041653) has the molecular formula C19H14F3NO3 and a molecular weight of 361.32 g/mol. Its IUPAC name is 2-(4-methoxy-2-methylphenyl)-8-(trifluoromethyl)quinoline-4-carboxylic acid.
| Compound Name | 2-(4-methoxy-2-methylphenyl)-8-(trifluoromethyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4041653 |
| Molecular Formula | C19H14F3NO3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-(4-methoxy-2-methylphenyl)-8-(trifluoromethyl)quinoline-4-carboxylic acid |
| SMILES | COc1ccc(-c2cc(C(=O)O)c3cccc(C(F)(F)F)c3n2)c(C)c1 |
| InChI | InChI=1S/C19H14F3NO3/c1-10-8-11(26-2)6-7-12(10)16-9-14(18(24)25)13-4-3-5-15(17(13)23-16)19(20,21)22/h3-9H,1-2H3,(H,24,25) |
| InChIKey | AOAYBGONLPQNHL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |