C20H19NO4 — CID 3972105
2-(2,5-dimethoxyphenyl)-5,8-dimethylquinoline-4-carboxylic acid (PubChem CID 3972105) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-5,8-dimethylquinoline-4-carboxylic acid.
| Compound Name | 2-(2,5-dimethoxyphenyl)-5,8-dimethylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3972105 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-5,8-dimethylquinoline-4-carboxylic acid |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)O)c3c(C)ccc(C)c3n2)c1 |
| InChI | InChI=1S/C20H19NO4/c1-11-5-6-12(2)19-18(11)15(20(22)23)10-16(21-19)14-9-13(24-3)7-8-17(14)25-4/h5-10H,1-4H3,(H,22,23) |
| InChIKey | QSOLYDRLZFASFB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |