C18H13Cl2NO3 — CID 46779499
8-chloro-2-(2,5-dimethoxyphenyl)quinoline-4-carbonyl chloride (PubChem CID 46779499) has the molecular formula C18H13Cl2NO3 and a molecular weight of 362.21 g/mol. Its IUPAC name is 8-chloro-2-(2,5-dimethoxyphenyl)quinoline-4-carbonyl chloride.
| Compound Name | 8-chloro-2-(2,5-dimethoxyphenyl)quinoline-4-carbonyl chloride |
|---|---|
| PubChem CID | 46779499 |
| Molecular Formula | C18H13Cl2NO3 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 8-chloro-2-(2,5-dimethoxyphenyl)quinoline-4-carbonyl chloride |
| SMILES | COc1ccc(OC)c(-c2cc(C(=O)Cl)c3cccc(Cl)c3n2)c1 |
| InChI | InChI=1S/C18H13Cl2NO3/c1-23-10-6-7-16(24-2)13(8-10)15-9-12(18(20)22)11-4-3-5-14(19)17(11)21-15/h3-9H,1-2H3 |
| InChIKey | KFVQVFLCBFBYGS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|