C19H12ClNO4 — CID 5014562
8-chloro-2-(5-methoxy-1-benzofuran-2-yl)quinoline-4-carboxylic acid (PubChem CID 5014562) has the molecular formula C19H12ClNO4 and a molecular weight of 353.76 g/mol. Its IUPAC name is 8-chloro-2-(5-methoxy-1-benzofuran-2-yl)quinoline-4-carboxylic acid.
| Compound Name | 8-chloro-2-(5-methoxy-1-benzofuran-2-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 5014562 |
| Molecular Formula | C19H12ClNO4 |
| Molecular Weight | 353.76 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 8-chloro-2-(5-methoxy-1-benzofuran-2-yl)quinoline-4-carboxylic acid |
| SMILES | COc1ccc2oc(-c3cc(C(=O)O)c4cccc(Cl)c4n3)cc2c1 |
| InChI | InChI=1S/C19H12ClNO4/c1-24-11-5-6-16-10(7-11)8-17(25-16)15-9-13(19(22)23)12-3-2-4-14(20)18(12)21-15/h2-9H,1H3,(H,22,23) |
| InChIKey | YQZBPJNBRALOER-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |