C19H9ClF3NO3 — CID 4039688
2-(5-chloro-1-benzofuran-2-yl)-8-(trifluoromethyl)quinoline-4-carboxylic acid (PubChem CID 4039688) has the molecular formula C19H9ClF3NO3 and a molecular weight of 391.73 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-8-(trifluoromethyl)quinoline-4-carboxylic acid.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-8-(trifluoromethyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4039688 |
| Molecular Formula | C19H9ClF3NO3 |
| Molecular Weight | 391.73 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-8-(trifluoromethyl)quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc3cc(Cl)ccc3o2)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C19H9ClF3NO3/c20-10-4-5-15-9(6-10)7-16(27-15)14-8-12(18(25)26)11-2-1-3-13(17(11)24-14)19(21,22)23/h1-8H,(H,25,26) |
| InChIKey | CKZWFEMHWVNOSJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |