C17H10Cl2NO3- — CID 7139771
2-(2,6-dichlorophenyl)-8-methoxyquinoline-4-carboxylate (PubChem CID 7139771) has the molecular formula C17H10Cl2NO3- and a molecular weight of 347.18 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-8-methoxyquinoline-4-carboxylate.
| Compound Name | 2-(2,6-dichlorophenyl)-8-methoxyquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7139771 |
| Molecular Formula | C17H10Cl2NO3- |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-8-methoxyquinoline-4-carboxylate |
| SMILES | COc1cccc2c(C(=O)[O-])cc(-c3c(Cl)cccc3Cl)nc12 |
| InChI | InChI=1S/C17H11Cl2NO3/c1-23-14-7-2-4-9-10(17(21)22)8-13(20-16(9)14)15-11(18)5-3-6-12(15)19/h2-8H,1H3,(H,21,22)/p-1 |
| InChIKey | WAAVHZHDNMXYOC-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |