C23H23BrNO5- — CID 7139869
2-(3-bromo-5-methoxy-4-pentoxyphenyl)-8-methoxyquinoline-4-carboxylate (PubChem CID 7139869) has the molecular formula C23H23BrNO5- and a molecular weight of 473.34 g/mol. Its IUPAC name is 2-(3-bromo-5-methoxy-4-pentoxyphenyl)-8-methoxyquinoline-4-carboxylate.
| Compound Name | 2-(3-bromo-5-methoxy-4-pentoxyphenyl)-8-methoxyquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7139869 |
| Molecular Formula | C23H23BrNO5- |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 2-(3-bromo-5-methoxy-4-pentoxyphenyl)-8-methoxyquinoline-4-carboxylate |
| SMILES | CCCCCOc1c(Br)cc(-c2cc(C(=O)[O-])c3cccc(OC)c3n2)cc1OC |
| InChI | InChI=1S/C23H24BrNO5/c1-4-5-6-10-30-22-17(24)11-14(12-20(22)29-3)18-13-16(23(26)27)15-8-7-9-19(28-2)21(15)25-18/h7-9,11-13H,4-6,10H2,1-3H3,(H,26,27)/p-1 |
| InChIKey | GBKUHNSIQAWTCQ-UHFFFAOYSA-M |
| XLogP | 4.61 |
| TPSA | 80.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|