About 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate
2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 7745239) has the molecular formula C15H15BrNO4S-
and a molecular weight of 385.26 g/mol. Its IUPAC name is 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 7745239 |
| Molecular Formula | C15H15BrNO4S- |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCOc1c(Br)cc(-c2nc(C)c(C(=O)[O-])s2)cc1OC |
| InChI | InChI=1S/C15H16BrNO4S/c1-4-5-21-12-10(16)6-9(7-11(12)20-3)14-17-8(2)13(22-14)15(18)19/h6-7H,4-5H2,1-3H3,(H,18,19)/p-1 |
| InChIKey | BGTWEPWGRJXWCC-UHFFFAOYSA-M |
| XLogP | 3.04 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate (CID 7745239) is 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate is CCCOc1c(Br)cc(-c2nc(C)c(C(=O)[O-])s2)cc1OC.
What is the InChIKey of 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is BGTWEPWGRJXWCC-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H16BrNO4S/c1-4-5-21-12-10(16)6-9(7-11(12)20-3)14-17-8(2)13(22-14)15(18)19/h6-7H,4-5H2,1-3H3,(H,18,19)/p-1.
What are the key properties of 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate?
2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 385.26 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-5-methoxy-4-propoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 7745239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).