C17H19BrNO4S- — CID 7745237
2-(3-bromo-5-methoxy-4-pentoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 7745237) has the molecular formula C17H19BrNO4S- and a molecular weight of 413.31 g/mol. Its IUPAC name is 2-(3-bromo-5-methoxy-4-pentoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | 2-(3-bromo-5-methoxy-4-pentoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 7745237 |
| Molecular Formula | C17H19BrNO4S- |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 2-(3-bromo-5-methoxy-4-pentoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCOc1c(Br)cc(-c2nc(C)c(C(=O)[O-])s2)cc1OC |
| InChI | InChI=1S/C17H20BrNO4S/c1-4-5-6-7-23-14-12(18)8-11(9-13(14)22-3)16-19-10(2)15(24-16)17(20)21/h8-9H,4-7H2,1-3H3,(H,20,21)/p-1 |
| InChIKey | DIXNXVLUXBZIGT-UHFFFAOYSA-M |
| XLogP | 3.82 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|