C15H16BrNO3S — CID 20990459
2-(3-bromo-4-butoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 20990459) has the molecular formula C15H16BrNO3S and a molecular weight of 370.27 g/mol. Its IUPAC name is 2-(3-bromo-4-butoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(3-bromo-4-butoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 20990459 |
| Molecular Formula | C15H16BrNO3S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 2-(3-bromo-4-butoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCCOc1ccc(-c2nc(C)c(C(=O)O)s2)cc1Br |
| InChI | InChI=1S/C15H16BrNO3S/c1-3-4-7-20-12-6-5-10(8-11(12)16)14-17-9(2)13(21-14)15(18)19/h5-6,8H,3-4,7H2,1-2H3,(H,18,19) |
| InChIKey | DXRGEBFBHUXSLA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|