C20H29N3O4S — CID 54588801
butan-1-amine;2-[3-[(E)-hydroxyiminomethyl]-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 54588801) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is butan-1-amine;2-[3-[(E)-hydroxyiminomethyl]-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | butan-1-amine;2-[3-[(E)-hydroxyiminomethyl]-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 54588801 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | butan-1-amine;2-[3-[(E)-hydroxyiminomethyl]-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCCN.Cc1nc(-c2ccc(OCC(C)C)c(/C=N/O)c2)sc1C(=O)O |
| InChI | InChI=1S/C16H18N2O4S.C4H11N/c1-9(2)8-22-13-5-4-11(6-12(13)7-17-21)15-18-10(3)14(23-15)16(19)20;1-2-3-4-5/h4-7,9,21H,8H2,1-3H3,(H,19,20);2-5H2,1H3/b17-7+; |
| InChIKey | QBHTWIQQYPBSSL-VYYXIRCESA-N |
| XLogP | 4.40 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|