C18H20N2O3S — CID 58567961
ethyl 2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 58567961) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is ethyl 2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 58567961 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | ethyl 2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | [C-]#[N+]c1cc(-c2nc(C)c(C(=O)OCC)s2)ccc1OCC(C)C |
| InChI | InChI=1S/C18H20N2O3S/c1-6-22-18(21)16-12(4)20-17(24-16)13-7-8-15(14(9-13)19-5)23-10-11(2)3/h7-9,11H,6,10H2,1-4H3 |
| InChIKey | KHQITIOPJVRXOX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|