C22H27N3O7S — CID 155771484
2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 155771484) has the molecular formula C22H27N3O7S and a molecular weight of 477.54 g/mol. Its IUPAC name is 2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155771484 |
| Molecular Formula | C22H27N3O7S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | [C-]#[N+]c1cc(-c2nc(C)c(C(=O)NC(C=O)C(O)C(O)C(O)CO)s2)ccc1OCC(C)C |
| InChI | InChI=1S/C22H27N3O7S/c1-11(2)10-32-17-6-5-13(7-14(17)23-4)22-24-12(3)20(33-22)21(31)25-15(8-26)18(29)19(30)16(28)9-27/h5-8,11,15-16,18-19,27-30H,9-10H2,1-3H3,(H,25,31) |
| InChIKey | WCBZUVOSZYFAJE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 153.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|