C22H28N4O2S — CID 168841382
[2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazol-5-yl]-(4-methyl-1,4-diazepan-1-yl)methanone (PubChem CID 168841382) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is [2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazol-5-yl]-(4-methyl-1,4-diazepan-1-yl)methanone.
| Compound Name | [2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazol-5-yl]-(4-methyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 168841382 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazol-5-yl]-(4-methyl-1,4-diazepan-1-yl)methanone |
| SMILES | [C-]#[N+]c1cc(-c2nc(C)c(C(=O)N3CCCN(C)CC3)s2)ccc1OCC(C)C |
| InChI | InChI=1S/C22H28N4O2S/c1-15(2)14-28-19-8-7-17(13-18(19)23-4)21-24-16(3)20(29-21)22(27)26-10-6-9-25(5)11-12-26/h7-8,13,15H,6,9-12,14H2,1-3,5H3 |
| InChIKey | VHRIPLOFTUUKKU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|