C22H28N4O3S — CID 168841394
2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-(2-morpholin-4-ylethyl)-1,3-thiazole-5-carboxamide (PubChem CID 168841394) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-(2-morpholin-4-ylethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-(2-morpholin-4-ylethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 168841394 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-[3-isocyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-(2-morpholin-4-ylethyl)-1,3-thiazole-5-carboxamide |
| SMILES | [C-]#[N+]c1cc(-c2nc(C)c(C(=O)NCCN3CCOCC3)s2)ccc1OCC(C)C |
| InChI | InChI=1S/C22H28N4O3S/c1-15(2)14-29-19-6-5-17(13-18(19)23-4)22-25-16(3)20(30-22)21(27)24-7-8-26-9-11-28-12-10-26/h5-6,13,15H,7-12,14H2,1-3H3,(H,24,27) |
| InChIKey | UHTWLPHJSUTLBC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 68.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|