C21H23NO3S — CID 20984783
2-(2-hexoxynaphthalen-1-yl)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 20984783) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-(2-hexoxynaphthalen-1-yl)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2-hexoxynaphthalen-1-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 20984783 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-(2-hexoxynaphthalen-1-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCCCCOc1ccc2ccccc2c1-c1nc(C)c(C(=O)O)s1 |
| InChI | InChI=1S/C21H23NO3S/c1-3-4-5-8-13-25-17-12-11-15-9-6-7-10-16(15)18(17)20-22-14(2)19(26-20)21(23)24/h6-7,9-12H,3-5,8,13H2,1-2H3,(H,23,24) |
| InChIKey | STPIFVSCMBAFKP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|