C14H16N2O4S — CID 12813043
4-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 12813043) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 12813043 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | COc1cc(-c2nc(C)c(C(N)=O)s2)cc(OC)c1OC |
| InChI | InChI=1S/C14H16N2O4S/c1-7-12(13(15)17)21-14(16-7)8-5-9(18-2)11(20-4)10(6-8)19-3/h5-6H,1-4H3,(H2,15,17) |
| InChIKey | OXWRIAJMFOSJDJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |