C14H13BrNO4S- — CID 7745185
2-[2-(3-bromo-4-ethoxy-5-methoxyphenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 7745185) has the molecular formula C14H13BrNO4S- and a molecular weight of 371.23 g/mol. Its IUPAC name is 2-[2-(3-bromo-4-ethoxy-5-methoxyphenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-(3-bromo-4-ethoxy-5-methoxyphenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 7745185 |
| Molecular Formula | C14H13BrNO4S- |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 2-[2-(3-bromo-4-ethoxy-5-methoxyphenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOc1c(Br)cc(-c2nc(CC(=O)[O-])cs2)cc1OC |
| InChI | InChI=1S/C14H14BrNO4S/c1-3-20-13-10(15)4-8(5-11(13)19-2)14-16-9(7-21-14)6-12(17)18/h4-5,7H,3,6H2,1-2H3,(H,17,18)/p-1 |
| InChIKey | IHXPCVJOFDKIIL-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |