C13H11BrClNO3S — CID 20984834
2-[2-(3-bromo-5-chloro-2-ethoxyphenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 20984834) has the molecular formula C13H11BrClNO3S and a molecular weight of 376.66 g/mol. Its IUPAC name is 2-[2-(3-bromo-5-chloro-2-ethoxyphenyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(3-bromo-5-chloro-2-ethoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 20984834 |
| Molecular Formula | C13H11BrClNO3S |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | 2-[2-(3-bromo-5-chloro-2-ethoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCOc1c(Br)cc(Cl)cc1-c1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C13H11BrClNO3S/c1-2-19-12-9(3-7(15)4-10(12)14)13-16-8(6-20-13)5-11(17)18/h3-4,6H,2,5H2,1H3,(H,17,18) |
| InChIKey | YZFYUENPVUPPOD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |