C13H12ClNO4S — CID 63631665
2-[2-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 63631665) has the molecular formula C13H12ClNO4S and a molecular weight of 313.76 g/mol. Its IUPAC name is 2-[2-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 63631665 |
| Molecular Formula | C13H12ClNO4S |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 2-[2-(2-chloro-3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1ccc(-c2nc(CC(=O)O)cs2)c(Cl)c1OC |
| InChI | InChI=1S/C13H12ClNO4S/c1-18-9-4-3-8(11(14)12(9)19-2)13-15-7(6-20-13)5-10(16)17/h3-4,6H,5H2,1-2H3,(H,16,17) |
| InChIKey | CTONRDYIIGKGKD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |