C20H23BrN2O2 — CID 19224134
2-(3-bromo-4-hexoxy-5-methoxyphenyl)-1H-benzimidazole (PubChem CID 19224134) has the molecular formula C20H23BrN2O2 and a molecular weight of 403.32 g/mol. Its IUPAC name is 2-(3-bromo-4-hexoxy-5-methoxyphenyl)-1H-benzimidazole.
| Compound Name | 2-(3-bromo-4-hexoxy-5-methoxyphenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 19224134 |
| Molecular Formula | C20H23BrN2O2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 2-(3-bromo-4-hexoxy-5-methoxyphenyl)-1H-benzimidazole |
| SMILES | CCCCCCOc1c(Br)cc(-c2nc3ccccc3[nH]2)cc1OC |
| InChI | InChI=1S/C20H23BrN2O2/c1-3-4-5-8-11-25-19-15(21)12-14(13-18(19)24-2)20-22-16-9-6-7-10-17(16)23-20/h6-7,9-10,12-13H,3-5,8,11H2,1-2H3,(H,22,23) |
| InChIKey | KPQVINMUDKYVMM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|