C20H24N2O2 — CID 168553618
2-(2-hexoxy-3-methoxyphenyl)-1H-benzimidazole (PubChem CID 168553618) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-(2-hexoxy-3-methoxyphenyl)-1H-benzimidazole.
| Compound Name | 2-(2-hexoxy-3-methoxyphenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 168553618 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-(2-hexoxy-3-methoxyphenyl)-1H-benzimidazole |
| SMILES | CCCCCCOc1c(OC)cccc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H24N2O2/c1-3-4-5-8-14-24-19-15(10-9-13-18(19)23-2)20-21-16-11-6-7-12-17(16)22-20/h6-7,9-13H,3-5,8,14H2,1-2H3,(H,21,22) |
| InChIKey | WCOSPZAKLQMTTP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|