C19H16N2O2 — CID 168555188
2-(3,5-dimethoxynaphthalen-2-yl)-1H-benzimidazole (PubChem CID 168555188) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(3,5-dimethoxynaphthalen-2-yl)-1H-benzimidazole.
| Compound Name | 2-(3,5-dimethoxynaphthalen-2-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 168555188 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-(3,5-dimethoxynaphthalen-2-yl)-1H-benzimidazole |
| SMILES | COc1cc2c(OC)cccc2cc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H16N2O2/c1-22-17-9-5-6-12-10-14(18(23-2)11-13(12)17)19-20-15-7-3-4-8-16(15)21-19/h3-11H,1-2H3,(H,20,21) |
| InChIKey | KUTLGEKGYAQWSK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |