C14H16BrO4- — CID 7832383
(E)-3-(3-bromo-4-butoxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 7832383) has the molecular formula C14H16BrO4- and a molecular weight of 328.18 g/mol. Its IUPAC name is (E)-3-(3-bromo-4-butoxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | (E)-3-(3-bromo-4-butoxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7832383 |
| Molecular Formula | C14H16BrO4- |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | (E)-3-(3-bromo-4-butoxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCOc1c(Br)cc(/C=C/C(=O)[O-])cc1OC |
| InChI | InChI=1S/C14H17BrO4/c1-3-4-7-19-14-11(15)8-10(5-6-13(16)17)9-12(14)18-2/h5-6,8-9H,3-4,7H2,1-2H3,(H,16,17)/p-1/b6-5+ |
| InChIKey | WDOADWGLUYPFEO-AATRIKPKSA-M |
| XLogP | 2.40 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|