C15H18Br2O4 — CID 107739339
(E)-3-[3,5-dibromo-4-(2-butoxyethoxy)phenyl]prop-2-enoic acid (PubChem CID 107739339) has the molecular formula C15H18Br2O4 and a molecular weight of 422.11 g/mol. Its IUPAC name is (E)-3-[3,5-dibromo-4-(2-butoxyethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dibromo-4-(2-butoxyethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107739339 |
| Molecular Formula | C15H18Br2O4 |
| Molecular Weight | 422.11 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | (E)-3-[3,5-dibromo-4-(2-butoxyethoxy)phenyl]prop-2-enoic acid |
| SMILES | CCCCOCCOc1c(Br)cc(/C=C/C(=O)O)cc1Br |
| InChI | InChI=1S/C15H18Br2O4/c1-2-3-6-20-7-8-21-15-12(16)9-11(10-13(15)17)4-5-14(18)19/h4-5,9-10H,2-3,6-8H2,1H3,(H,18,19)/b5-4+ |
| InChIKey | BSEMAPGWBRFERZ-SNAWJCMRSA-N |
| XLogP | 4.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.11 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|