C15H18BrClO3 — CID 22686234
(E)-3-(3-bromo-5-chloro-2-hexoxyphenyl)prop-2-enoic acid (PubChem CID 22686234) has the molecular formula C15H18BrClO3 and a molecular weight of 361.66 g/mol. Its IUPAC name is (E)-3-(3-bromo-5-chloro-2-hexoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(3-bromo-5-chloro-2-hexoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 22686234 |
| Molecular Formula | C15H18BrClO3 |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | (E)-3-(3-bromo-5-chloro-2-hexoxyphenyl)prop-2-enoic acid |
| SMILES | CCCCCCOc1c(Br)cc(Cl)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C15H18BrClO3/c1-2-3-4-5-8-20-15-11(6-7-14(18)19)9-12(17)10-13(15)16/h6-7,9-10H,2-5,8H2,1H3,(H,18,19)/b7-6+ |
| InChIKey | HNGLFGBYMJHWBA-VOTSOKGWSA-N |
| XLogP | 5.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|