C13H15BrClNO3 — CID 22684747
3-[3-bromo-5-chloro-2-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 22684747) has the molecular formula C13H15BrClNO3 and a molecular weight of 348.62 g/mol. Its IUPAC name is 3-[3-bromo-5-chloro-2-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-bromo-5-chloro-2-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22684747 |
| Molecular Formula | C13H15BrClNO3 |
| Molecular Weight | 348.62 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 3-[3-bromo-5-chloro-2-[2-(dimethylamino)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | CN(C)CCOc1c(Br)cc(Cl)cc1C=CC(=O)O |
| InChI | InChI=1S/C13H15BrClNO3/c1-16(2)5-6-19-13-9(3-4-12(17)18)7-10(15)8-11(13)14/h3-4,7-8H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | WKRIMVBRBLYCJB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|