C14H16Br2O3 — CID 107739271
(E)-3-(3,5-dibromo-4-pentoxyphenyl)prop-2-enoic acid (PubChem CID 107739271) has the molecular formula C14H16Br2O3 and a molecular weight of 392.09 g/mol. Its IUPAC name is (E)-3-(3,5-dibromo-4-pentoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(3,5-dibromo-4-pentoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 107739271 |
| Molecular Formula | C14H16Br2O3 |
| Molecular Weight | 392.09 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | (E)-3-(3,5-dibromo-4-pentoxyphenyl)prop-2-enoic acid |
| SMILES | CCCCCOc1c(Br)cc(/C=C/C(=O)O)cc1Br |
| InChI | InChI=1S/C14H16Br2O3/c1-2-3-4-7-19-14-11(15)8-10(9-12(14)16)5-6-13(17)18/h5-6,8-9H,2-4,7H2,1H3,(H,17,18)/b6-5+ |
| InChIKey | YCPYNUSQWIGZAJ-AATRIKPKSA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.09 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|