C14H13Br2NO3 — CID 107739237
(E)-3-[3,5-dibromo-4-(4-cyanobutoxy)phenyl]prop-2-enoic acid (PubChem CID 107739237) has the molecular formula C14H13Br2NO3 and a molecular weight of 403.07 g/mol. Its IUPAC name is (E)-3-[3,5-dibromo-4-(4-cyanobutoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dibromo-4-(4-cyanobutoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107739237 |
| Molecular Formula | C14H13Br2NO3 |
| Molecular Weight | 403.07 g/mol |
| Exact Mass | 400.93 |
| IUPAC Name | (E)-3-[3,5-dibromo-4-(4-cyanobutoxy)phenyl]prop-2-enoic acid |
| SMILES | N#CCCCCOc1c(Br)cc(/C=C/C(=O)O)cc1Br |
| InChI | InChI=1S/C14H13Br2NO3/c15-11-8-10(4-5-13(18)19)9-12(16)14(11)20-7-3-1-2-6-17/h4-5,8-9H,1-3,7H2,(H,18,19)/b5-4+ |
| InChIKey | PEGGAPRYBUNEOV-SNAWJCMRSA-N |
| XLogP | 4.38 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.07 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|